C17H14ClFN2O5S2 — CID 66935366
4-(5-chlorothiophen-2-yl)sulfonyl-6-[(5-fluoro-2-methoxyphenyl)methylidene]-1,4-diazepane-2,5-dione (PubChem CID 66935366) has the molecular formula C17H14ClFN2O5S2 and a molecular weight of 444.89 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-6-[(5-fluoro-2-methoxyphenyl)methylidene]-1,4-diazepane-2,5-dione.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-6-[(5-fluoro-2-methoxyphenyl)methylidene]-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 66935366 |
| Molecular Formula | C17H14ClFN2O5S2 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-6-[(5-fluoro-2-methoxyphenyl)methylidene]-1,4-diazepane-2,5-dione |
| SMILES | COc1ccc(F)cc1C=C1CNC(=O)CN(S(=O)(=O)c2ccc(Cl)s2)C1=O |
| InChI | InChI=1S/C17H14ClFN2O5S2/c1-26-13-3-2-12(19)7-10(13)6-11-8-20-15(22)9-21(17(11)23)28(24,25)16-5-4-14(18)27-16/h2-7H,8-9H2,1H3,(H,20,22) |
| InChIKey | VRAKAYPYEAAXEC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|