C27H34Cl2N3O5PS — CID 143586677
6-[(5-chloro-2-methoxyphenyl)methyl]-4-[4-chloro-3-(morpholine-4-carbonyl)phenyl]sulfanyl-1,4-diazepane-2,5-dione;propan-2-ylphosphane (PubChem CID 143586677) has the molecular formula C27H34Cl2N3O5PS and a molecular weight of 614.53 g/mol. Its IUPAC name is 6-[(5-chloro-2-methoxyphenyl)methyl]-4-[4-chloro-3-(morpholine-4-carbonyl)phenyl]sulfanyl-1,4-diazepane-2,5-dione;propan-2-ylphosphane.
| Compound Name | 6-[(5-chloro-2-methoxyphenyl)methyl]-4-[4-chloro-3-(morpholine-4-carbonyl)phenyl]sulfanyl-1,4-diazepane-2,5-dione;propan-2-ylphosphane |
|---|---|
| PubChem CID | 143586677 |
| Molecular Formula | C27H34Cl2N3O5PS |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 613.13 |
| IUPAC Name | 6-[(5-chloro-2-methoxyphenyl)methyl]-4-[4-chloro-3-(morpholine-4-carbonyl)phenyl]sulfanyl-1,4-diazepane-2,5-dione;propan-2-ylphosphane |
| SMILES | CC(C)P.COc1ccc(Cl)cc1CC1CNC(=O)CN(Sc2ccc(Cl)c(C(=O)N3CCOCC3)c2)C1=O |
| InChI | InChI=1S/C24H25Cl2N3O5S.C3H9P/c1-33-21-5-2-17(25)11-15(21)10-16-13-27-22(30)14-29(23(16)31)35-18-3-4-20(26)19(12-18)24(32)28-6-8-34-9-7-28;1-3(2)4/h2-5,11-12,16H,6-10,13-14H2,1H3,(H,27,30);3H,4H2,1-2H3 |
| InChIKey | HVQVKNQXFUABEW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|