C30H29ClFN3O6 — CID 172929758
2-amino-4-[3-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(4-fluorophenoxy)imino-2-oxoazepan-1-yl]-3-oxopropyl]benzoic acid (PubChem CID 172929758) has the molecular formula C30H29ClFN3O6 and a molecular weight of 582.03 g/mol. Its IUPAC name is 2-amino-4-[3-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(4-fluorophenoxy)imino-2-oxoazepan-1-yl]-3-oxopropyl]benzoic acid.
| Compound Name | 2-amino-4-[3-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(4-fluorophenoxy)imino-2-oxoazepan-1-yl]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 172929758 |
| Molecular Formula | C30H29ClFN3O6 |
| Molecular Weight | 582.03 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | 2-amino-4-[3-[(6E)-3-[(5-chloro-2-methoxyphenyl)methyl]-6-(4-fluorophenoxy)imino-2-oxoazepan-1-yl]-3-oxopropyl]benzoic acid |
| SMILES | COc1ccc(Cl)cc1CC1CC/C(=N\Oc2ccc(F)cc2)CN(C(=O)CCc2ccc(C(=O)O)c(N)c2)C1=O |
| InChI | InChI=1S/C30H29ClFN3O6/c1-40-27-12-5-21(31)16-20(27)15-19-4-8-23(34-41-24-9-6-22(32)7-10-24)17-35(29(19)37)28(36)13-3-18-2-11-25(30(38)39)26(33)14-18/h2,5-7,9-12,14,16,19H,3-4,8,13,15,17,33H2,1H3,(H,38,39)/b34-23+ |
| InChIKey | WLNKXHOTLUNYFL-PPFNPFNJSA-N |
| XLogP | 5.14 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|