C37H60F2N4O2 — CID 143238894
N-(cyclohexa-1,5-dien-1-ylmethyl)-1-[ethenyl(ethyl)amino]-N,3-dimethyl-5-methylidenecyclohexane-1-carboxamide;4,4-difluorocyclohexane-1-carboxamide;(Z,4Z)-4-ethylidenehept-5-en-1-amine (PubChem CID 143238894) has the molecular formula C37H60F2N4O2 and a molecular weight of 630.91 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-1-[ethenyl(ethyl)amino]-N,3-dimethyl-5-methylidenecyclohexane-1-carboxamide;4,4-difluorocyclohexane-1-carboxamide;(Z,4Z)-4-ethylidenehept-5-en-1-amine.
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-1-[ethenyl(ethyl)amino]-N,3-dimethyl-5-methylidenecyclohexane-1-carboxamide;4,4-difluorocyclohexane-1-carboxamide;(Z,4Z)-4-ethylidenehept-5-en-1-amine |
|---|---|
| PubChem CID | 143238894 |
| Molecular Formula | C37H60F2N4O2 |
| Molecular Weight | 630.91 g/mol |
| Exact Mass | 630.47 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-1-[ethenyl(ethyl)amino]-N,3-dimethyl-5-methylidenecyclohexane-1-carboxamide;4,4-difluorocyclohexane-1-carboxamide;(Z,4Z)-4-ethylidenehept-5-en-1-amine |
| SMILES | C/C=C\C(=C/C)CCCN.C=CN(CC)C1(C(=O)N(C)CC2=CCCC=C2)CC(=C)CC(C)C1.NC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H32N2O.C9H17N.C7H11F2NO/c1-6-23(7-2)21(14-17(3)13-18(4)15-21)20(24)22(5)16-19-11-9-8-10-12-19;1-3-6-9(4-2)7-5-8-10;8-7(9)3-1-5(2-4-7)6(10)11/h6,9,11-12,18H,1,3,7-8,10,13-16H2,2,4-5H3;3-4,6H,5,7-8,10H2,1-2H3;5H,1-4H2,(H2,10,11)/b;6-3-,9-4+; |
| InChIKey | SEOXQXIZZKJXAW-ODNHCADGSA-N |
| XLogP | 7.85 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.91 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|