C15H24N2O4 — CID 143239707
furan-3-yl-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone;N-propan-2-ylacetamide (PubChem CID 143239707) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is furan-3-yl-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone;N-propan-2-ylacetamide.
| Compound Name | furan-3-yl-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone;N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 143239707 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | furan-3-yl-(4-hydroxy-2-methylpyrrolidin-1-yl)methanone;N-propan-2-ylacetamide |
| SMILES | CC(=O)NC(C)C.CC1CC(O)CN1C(=O)c1ccoc1 |
| InChI | InChI=1S/C10H13NO3.C5H11NO/c1-7-4-9(12)5-11(7)10(13)8-2-3-14-6-8;1-4(2)6-5(3)7/h2-3,6-7,9,12H,4-5H2,1H3;4H,1-3H3,(H,6,7) |
| InChIKey | KIVBNTROGZHYDB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |