C12H13FN4O4S — CID 143247423
5-amino-3-[(2R,3S,4R,5R)-3-ethenyl-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 143247423) has the molecular formula C12H13FN4O4S and a molecular weight of 328.33 g/mol. Its IUPAC name is 5-amino-3-[(2R,3S,4R,5R)-3-ethenyl-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2R,3S,4R,5R)-3-ethenyl-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 143247423 |
| Molecular Formula | C12H13FN4O4S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-amino-3-[(2R,3S,4R,5R)-3-ethenyl-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | C=C[C@@H]1[C@@H](F)[C@@H](CO)O[C@H]1n1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H13FN4O4S/c1-2-4-6(13)5(3-18)21-10(4)17-8-7(22-12(17)20)9(19)16-11(14)15-8/h2,4-6,10,18H,1,3H2,(H3,14,15,16,19)/t4-,5-,6-,10-/m1/s1 |
| InChIKey | ZWDANDVLUMFFGC-PLDPKQSISA-N |
| XLogP | -0.24 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|