C16H15FO3S — CID 143248179
7-(3-fluorophenyl)sulfonyl-4-methyl-3,4-dihydro-2H-chromene (PubChem CID 143248179) has the molecular formula C16H15FO3S and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-(3-fluorophenyl)sulfonyl-4-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 7-(3-fluorophenyl)sulfonyl-4-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143248179 |
| Molecular Formula | C16H15FO3S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 7-(3-fluorophenyl)sulfonyl-4-methyl-3,4-dihydro-2H-chromene |
| SMILES | CC1CCOc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C16H15FO3S/c1-11-7-8-20-16-10-14(5-6-15(11)16)21(18,19)13-4-2-3-12(17)9-13/h2-6,9-11H,7-8H2,1H3 |
| InChIKey | OPFBJCCQOBPYKP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |