C13H17Cl2N3 — CID 143249669
3,4-dichloro-N-[1-(4-methylpiperazin-1-yl)ethenyl]aniline (PubChem CID 143249669) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(4-methylpiperazin-1-yl)ethenyl]aniline.
| Compound Name | 3,4-dichloro-N-[1-(4-methylpiperazin-1-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 143249669 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3,4-dichloro-N-[1-(4-methylpiperazin-1-yl)ethenyl]aniline |
| SMILES | C=C(Nc1ccc(Cl)c(Cl)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H17Cl2N3/c1-10(18-7-5-17(2)6-8-18)16-11-3-4-12(14)13(15)9-11/h3-4,9,16H,1,5-8H2,2H3 |
| InChIKey | WEZZFGIDILFXHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |