C26H36Cl2N4O2 — CID 143249802
4-[[(2S)-4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]morpholin-2-yl]methyl]-N-(3,4-dichlorophenyl)piperazine-1-carboxamide (PubChem CID 143249802) has the molecular formula C26H36Cl2N4O2 and a molecular weight of 507.51 g/mol. Its IUPAC name is 4-[[(2S)-4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]morpholin-2-yl]methyl]-N-(3,4-dichlorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[[(2S)-4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]morpholin-2-yl]methyl]-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 143249802 |
| Molecular Formula | C26H36Cl2N4O2 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[[(2S)-4-[4-[(1E)-buta-1,3-dienyl]cyclohexyl]morpholin-2-yl]methyl]-N-(3,4-dichlorophenyl)piperazine-1-carboxamide |
| SMILES | C=C/C=C/C1CCC(N2CCO[C@@H](CN3CCN(C(=O)Nc4ccc(Cl)c(Cl)c4)CC3)C2)CC1 |
| InChI | InChI=1S/C26H36Cl2N4O2/c1-2-3-4-20-5-8-22(9-6-20)32-15-16-34-23(19-32)18-30-11-13-31(14-12-30)26(33)29-21-7-10-24(27)25(28)17-21/h2-4,7,10,17,20,22-23H,1,5-6,8-9,11-16,18-19H2,(H,29,33)/b4-3+/t20?,22?,23-/m0/s1 |
| InChIKey | QMVNDXPLUXMJGR-BCGHAARQSA-N |
| XLogP | 5.14 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|