C23H25F6NO — CID 143249915
N-(2,2-dimethyl-1-phenylbutyl)-2-ethyl-4,6-bis(trifluoromethyl)benzamide (PubChem CID 143249915) has the molecular formula C23H25F6NO and a molecular weight of 445.45 g/mol. Its IUPAC name is N-(2,2-dimethyl-1-phenylbutyl)-2-ethyl-4,6-bis(trifluoromethyl)benzamide.
| Compound Name | N-(2,2-dimethyl-1-phenylbutyl)-2-ethyl-4,6-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143249915 |
| Molecular Formula | C23H25F6NO |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-(2,2-dimethyl-1-phenylbutyl)-2-ethyl-4,6-bis(trifluoromethyl)benzamide |
| SMILES | CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1C(=O)NC(c1ccccc1)C(C)(C)CC |
| InChI | InChI=1S/C23H25F6NO/c1-5-14-12-16(22(24,25)26)13-17(23(27,28)29)18(14)20(31)30-19(21(3,4)6-2)15-10-8-7-9-11-15/h7-13,19H,5-6H2,1-4H3,(H,30,31) |
| InChIKey | CJJBLHXXKFWWPE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |