C10H17N — CID 143252112
3-ethyl-6-propyl-2,3-dihydropyridine (PubChem CID 143252112) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-ethyl-6-propyl-2,3-dihydropyridine.
| Compound Name | 3-ethyl-6-propyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 143252112 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-ethyl-6-propyl-2,3-dihydropyridine |
| SMILES | CCCC1=NCC(CC)C=C1 |
| InChI | InChI=1S/C10H17N/c1-3-5-10-7-6-9(4-2)8-11-10/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | CYJIIYSCTTXLLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |