C28H36Cl2N2O5 — CID 143253299
N-[4-[(6E)-6-[3-chloro-5-[(Z)-3-chlorobut-2-enoxy]-2-methoxyphenyl]-6-methoxyiminohexoxy]phenyl]butanamide (PubChem CID 143253299) has the molecular formula C28H36Cl2N2O5 and a molecular weight of 551.51 g/mol. Its IUPAC name is N-[4-[(6E)-6-[3-chloro-5-[(Z)-3-chlorobut-2-enoxy]-2-methoxyphenyl]-6-methoxyiminohexoxy]phenyl]butanamide.
| Compound Name | N-[4-[(6E)-6-[3-chloro-5-[(Z)-3-chlorobut-2-enoxy]-2-methoxyphenyl]-6-methoxyiminohexoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 143253299 |
| Molecular Formula | C28H36Cl2N2O5 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | N-[4-[(6E)-6-[3-chloro-5-[(Z)-3-chlorobut-2-enoxy]-2-methoxyphenyl]-6-methoxyiminohexoxy]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(OCCCCC/C(=N\OC)c2cc(OC/C=C(/C)Cl)cc(Cl)c2OC)cc1 |
| InChI | InChI=1S/C28H36Cl2N2O5/c1-5-9-27(33)31-21-11-13-22(14-12-21)36-16-8-6-7-10-26(32-35-4)24-18-23(37-17-15-20(2)29)19-25(30)28(24)34-3/h11-15,18-19H,5-10,16-17H2,1-4H3,(H,31,33)/b20-15-,32-26+ |
| InChIKey | INEKHIGBNYTFNX-SXQTXDIXSA-N |
| XLogP | 7.60 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|