C20H29N — CID 143255664
ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile (PubChem CID 143255664) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile.
| Compound Name | ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile |
|---|---|
| PubChem CID | 143255664 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile |
| SMILES | C=C/C(C#N)=C\CC=C(C)c1cccc(C)c1.CC.CC |
| InChI | InChI=1S/C16H17N.2C2H6/c1-4-15(12-17)9-6-8-14(3)16-10-5-7-13(2)11-16;2*1-2/h4-5,7-11H,1,6H2,2-3H3;2*1-2H3/b14-8?,15-9+;; |
| InChIKey | BMPWRRLXXOMPJL-URRMDCBSSA-N |
| XLogP | 6.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|