About ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile
ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile (PubChem CID 143255664) has the molecular formula C20H29N
and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile.
Molecular Properties
| Compound Name | ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile |
| PubChem CID | 143255664 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile |
| SMILES | C=C/C(C#N)=C\CC=C(C)c1cccc(C)c1.CC.CC |
| InChI | InChI=1S/C16H17N.2C2H6/c1-4-15(12-17)9-6-8-14(3)16-10-5-7-13(2)11-16;2*1-2/h4-5,7-11H,1,6H2,2-3H3;2*1-2H3/b14-8?,15-9+;; |
| InChIKey | BMPWRRLXXOMPJL-URRMDCBSSA-N |
| XLogP | 6.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile?
The IUPAC name of ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile (CID 143255664) is ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile.
What is the SMILES notation for ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile?
The canonical SMILES for ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile is C=C/C(C#N)=C\CC=C(C)c1cccc(C)c1.CC.CC.
What is the InChIKey of ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile?
The InChIKey is BMPWRRLXXOMPJL-URRMDCBSSA-N. The full InChI is InChI=1S/C16H17N.2C2H6/c1-4-15(12-17)9-6-8-14(3)16-10-5-7-13(2)11-16;2*1-2/h4-5,7-11H,1,6H2,2-3H3;2*1-2H3/b14-8?,15-9+;;.
What are the key properties of ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile?
ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile has a molecular weight of 283.46 g/mol, XLogP of 6.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-ethenyl-6-(3-methylphenyl)hepta-2,5-dienenitrile is sourced from PubChem (CID 143255664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).