C22H28BrClN8O2 — CID 143255923
4-amino-6-[4-(4-chloro-N-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]anilino)piperidin-1-yl]pyrimidine-5-carboximidoyl bromide (PubChem CID 143255923) has the molecular formula C22H28BrClN8O2 and a molecular weight of 551.88 g/mol. Its IUPAC name is 4-amino-6-[4-(4-chloro-N-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]anilino)piperidin-1-yl]pyrimidine-5-carboximidoyl bromide.
| Compound Name | 4-amino-6-[4-(4-chloro-N-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]anilino)piperidin-1-yl]pyrimidine-5-carboximidoyl bromide |
|---|---|
| PubChem CID | 143255923 |
| Molecular Formula | C22H28BrClN8O2 |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 4-amino-6-[4-(4-chloro-N-[2-[2-(dimethylamino)ethylamino]-2-oxoacetyl]anilino)piperidin-1-yl]pyrimidine-5-carboximidoyl bromide |
| SMILES | [H]/N=C(\Br)c1c(N)ncnc1N1CCC(N(C(=O)C(=O)NCCN(C)C)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H28BrClN8O2/c1-30(2)12-9-27-21(33)22(34)32(15-5-3-14(24)4-6-15)16-7-10-31(11-8-16)20-17(18(23)25)19(26)28-13-29-20/h3-6,13,16,25H,7-12H2,1-2H3,(H,27,33)(H2,26,28,29)/b25-18- |
| InChIKey | XYWWLVJCNANPQV-BWAHOGKJSA-N |
| XLogP | 2.11 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|