About ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine
ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine (PubChem CID 143256828) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine.
Molecular Properties
| Compound Name | ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine |
| PubChem CID | 143256828 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine |
| SMILES | C=C(C)/C=C1/NCOC1=C.CC.CC |
| InChI | InChI=1S/C8H11NO.2C2H6/c1-6(2)4-8-7(3)10-5-9-8;2*1-2/h4,9H,1,3,5H2,2H3;2*1-2H3/b8-4+;; |
| InChIKey | YVSHNJQZIZXIQF-ZDTICIBISA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine?
The IUPAC name of ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine (CID 143256828) is ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine.
What is the SMILES notation for ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine?
The canonical SMILES for ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine is C=C(C)/C=C1/NCOC1=C.CC.CC.
What is the InChIKey of ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine?
The InChIKey is YVSHNJQZIZXIQF-ZDTICIBISA-N. The full InChI is InChI=1S/C8H11NO.2C2H6/c1-6(2)4-8-7(3)10-5-9-8;2*1-2/h4,9H,1,3,5H2,2H3;2*1-2H3/b8-4+;;.
What are the key properties of ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine?
ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine has a molecular weight of 197.32 g/mol, XLogP of 3.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E)-5-methylidene-4-(2-methylprop-2-enylidene)-1,3-oxazolidine is sourced from PubChem (CID 143256828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).