C31H38F6N4O — CID 143258742
3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-(methylamino)ethoxymethyl]amino]methyl]-N-(cyclopentylmethyl)-N-ethylquinolin-2-amine (PubChem CID 143258742) has the molecular formula C31H38F6N4O and a molecular weight of 596.66 g/mol. Its IUPAC name is 3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-(methylamino)ethoxymethyl]amino]methyl]-N-(cyclopentylmethyl)-N-ethylquinolin-2-amine.
| Compound Name | 3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-(methylamino)ethoxymethyl]amino]methyl]-N-(cyclopentylmethyl)-N-ethylquinolin-2-amine |
|---|---|
| PubChem CID | 143258742 |
| Molecular Formula | C31H38F6N4O |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | 3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-(methylamino)ethoxymethyl]amino]methyl]-N-(cyclopentylmethyl)-N-ethylquinolin-2-amine |
| SMILES | CCN(CC1CCCC1)c1nc2ccccc2cc1CN(COCCNC)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H38F6N4O/c1-3-41(19-22-8-4-5-9-22)29-25(16-24-10-6-7-11-28(24)39-29)20-40(21-42-13-12-38-2)18-23-14-26(30(32,33)34)17-27(15-23)31(35,36)37/h6-7,10-11,14-17,22,38H,3-5,8-9,12-13,18-21H2,1-2H3 |
| InChIKey | SGQQHPXLESYRHD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|