C28H31F6N5 — CID 130282345
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]guanidine (PubChem CID 130282345) has the molecular formula C28H31F6N5 and a molecular weight of 551.58 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]guanidine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 130282345 |
| Molecular Formula | C28H31F6N5 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]guanidine |
| SMILES | [H]/N=C(\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc2ccccc2nc1N(CC)CC1CCCC1 |
| InChI | InChI=1S/C28H31F6N5/c1-2-38(15-18-7-3-4-8-18)25-21(13-20-9-5-6-10-24(20)37-25)17-39(26(35)36)16-19-11-22(27(29,30)31)14-23(12-19)28(32,33)34/h5-6,9-14,18H,2-4,7-8,15-17H2,1H3,(H3,35,36) |
| InChIKey | NWAIUHRZRGYSEQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|