C34H43F6N6O2+ — CID 152855243
[N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[[7-carboxy-2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]-N'-methylcarbamimidoyl]-(diethylamino)azanium (PubChem CID 152855243) has the molecular formula C34H43F6N6O2+ and a molecular weight of 681.75 g/mol. Its IUPAC name is [N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[[7-carboxy-2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]-N'-methylcarbamimidoyl]-(diethylamino)azanium.
| Compound Name | [N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[[7-carboxy-2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]-N'-methylcarbamimidoyl]-(diethylamino)azanium |
|---|---|
| PubChem CID | 152855243 |
| Molecular Formula | C34H43F6N6O2+ |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | [N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[[7-carboxy-2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]-N'-methylcarbamimidoyl]-(diethylamino)azanium |
| SMILES | CCN(CC)[NH2+]/C(=N\C)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc2ccc(C(=O)O)cc2nc1N(CC)CC1CCCC1 |
| InChI | InChI=1S/C34H42F6N6O2/c1-5-44(19-22-10-8-9-11-22)30-26(16-24-12-13-25(31(47)48)17-29(24)42-30)21-45(32(41-4)43-46(6-2)7-3)20-23-14-27(33(35,36)37)18-28(15-23)34(38,39)40/h12-18,22H,5-11,19-21H2,1-4H3,(H,41,43)(H,47,48)/p+1 |
| InChIKey | TWGJQVXQKJOOFU-UHFFFAOYSA-O |
| XLogP | 6.80 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|