C27H35F6N7 — CID 143578975
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5-ethyl-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine (PubChem CID 143578975) has the molecular formula C27H35F6N7 and a molecular weight of 571.61 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5-ethyl-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5-ethyl-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine |
|---|---|
| PubChem CID | 143578975 |
| Molecular Formula | C27H35F6N7 |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5-ethyl-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine |
| SMILES | CCc1cnc(N(CC)CC2CCCC2)c(CN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(N)=N/N=N/C)c1 |
| InChI | InChI=1S/C27H35F6N7/c1-4-18-10-21(24(36-14-18)39(5-2)15-19-8-6-7-9-19)17-40(25(34)37-38-35-3)16-20-11-22(26(28,29)30)13-23(12-20)27(31,32)33/h10-14,19H,4-9,15-17H2,1-3H3,(H2,34,35,37) |
| InChIKey | DVXPWUALEHQENT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|