C33H39F6N7O2 — CID 144627349
ethyl 2-[amino-[(E)-[amino-[[2-[bis(cyclopropylmethyl)amino]-8-methylquinolin-3-yl]methyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]methylidene]amino]amino]acetate (PubChem CID 144627349) has the molecular formula C33H39F6N7O2 and a molecular weight of 679.71 g/mol. Its IUPAC name is ethyl 2-[amino-[(E)-[amino-[[2-[bis(cyclopropylmethyl)amino]-8-methylquinolin-3-yl]methyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]methylidene]amino]amino]acetate.
| Compound Name | ethyl 2-[amino-[(E)-[amino-[[2-[bis(cyclopropylmethyl)amino]-8-methylquinolin-3-yl]methyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]methylidene]amino]amino]acetate |
|---|---|
| PubChem CID | 144627349 |
| Molecular Formula | C33H39F6N7O2 |
| Molecular Weight | 679.71 g/mol |
| Exact Mass | 679.31 |
| IUPAC Name | ethyl 2-[amino-[(E)-[amino-[[2-[bis(cyclopropylmethyl)amino]-8-methylquinolin-3-yl]methyl-[[3,5-bis(trifluoromethyl)phenyl]methyl]amino]methylidene]amino]amino]acetate |
| SMILES | CCOC(=O)CN(N)/N=C(\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc2cccc(C)c2nc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C33H39F6N7O2/c1-3-48-28(47)19-46(41)43-31(40)45(17-23-11-26(32(34,35)36)14-27(12-23)33(37,38)39)18-25-13-24-6-4-5-20(2)29(24)42-30(25)44(15-21-7-8-21)16-22-9-10-22/h4-6,11-14,21-22H,3,7-10,15-19,41H2,1-2H3,(H2,40,43) |
| InChIKey | NJIMGMSGXNIKNO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|