C28H36F6N6 — CID 130282325
1-[[2-[bis(cyclopropylmethyl)amino]-4,6-dimethyl-3-pyridinyl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(dimethylamino)guanidine (PubChem CID 130282325) has the molecular formula C28H36F6N6 and a molecular weight of 570.63 g/mol. Its IUPAC name is 1-[[2-[bis(cyclopropylmethyl)amino]-4,6-dimethyl-3-pyridinyl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(dimethylamino)guanidine.
| Compound Name | 1-[[2-[bis(cyclopropylmethyl)amino]-4,6-dimethyl-3-pyridinyl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(dimethylamino)guanidine |
|---|---|
| PubChem CID | 130282325 |
| Molecular Formula | C28H36F6N6 |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 1-[[2-[bis(cyclopropylmethyl)amino]-4,6-dimethyl-3-pyridinyl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(dimethylamino)guanidine |
| SMILES | Cc1cc(C)c(CN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(N)=N/N(C)C)c(N(CC2CC2)CC2CC2)n1 |
| InChI | InChI=1S/C28H36F6N6/c1-17-9-18(2)36-25(39(13-19-5-6-19)14-20-7-8-20)24(17)16-40(26(35)37-38(3)4)15-21-10-22(27(29,30)31)12-23(11-21)28(32,33)34/h9-12,19-20H,5-8,13-16H2,1-4H3,(H2,35,37) |
| InChIKey | ODMAWEAJZSXFEU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|