C31H37F6N7 — CID 130282150
2-[amino(methyl)amino]-1-[[2-[bis(cyclopropylmethyl)amino]-8-ethylquinolin-3-yl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 130282150) has the molecular formula C31H37F6N7 and a molecular weight of 621.67 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[2-[bis(cyclopropylmethyl)amino]-8-ethylquinolin-3-yl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[2-[bis(cyclopropylmethyl)amino]-8-ethylquinolin-3-yl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 130282150 |
| Molecular Formula | C31H37F6N7 |
| Molecular Weight | 621.67 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[2-[bis(cyclopropylmethyl)amino]-8-ethylquinolin-3-yl]methyl]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCc1cccc2cc(CN(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)/C(N)=N/N(C)N)c(N(CC3CC3)CC3CC3)nc12 |
| InChI | InChI=1S/C31H37F6N7/c1-3-22-5-4-6-23-13-24(28(40-27(22)23)43(15-19-7-8-19)16-20-9-10-20)18-44(29(38)41-42(2)39)17-21-11-25(30(32,33)34)14-26(12-21)31(35,36)37/h4-6,11-14,19-20H,3,7-10,15-18,39H2,1-2H3,(H2,38,41) |
| InChIKey | KQNDPVXMPUXGEM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|