C29H39F6N7 — CID 130282236
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]guanidine (PubChem CID 130282236) has the molecular formula C29H39F6N7 and a molecular weight of 599.67 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 130282236 |
| Molecular Formula | C29H39F6N7 |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentylmethyl(ethyl)amino]-5,6,7,8-tetrahydroquinolin-3-yl]methyl]guanidine |
| SMILES | CCN(CC1CCCC1)c1nc2c(cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)CCCC2 |
| InChI | InChI=1S/C29H39F6N7/c1-3-41(16-19-8-4-5-9-19)26-22(14-21-10-6-7-11-25(21)38-26)18-42(27(36)39-40(2)37)17-20-12-23(28(30,31)32)15-24(13-20)29(33,34)35/h12-15,19H,3-11,16-18,37H2,1-2H3,(H2,36,39) |
| InChIKey | BOUOTPIEYSDIKY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|