C30H36F6N6 — CID 130282149
N-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]amino]-N-methylethanimidamide (PubChem CID 130282149) has the molecular formula C30H36F6N6 and a molecular weight of 594.65 g/mol. Its IUPAC name is N-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]amino]-N-methylethanimidamide.
| Compound Name | N-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]amino]-N-methylethanimidamide |
|---|---|
| PubChem CID | 130282149 |
| Molecular Formula | C30H36F6N6 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | N-amino-2-[[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-[cyclopentylmethyl(ethyl)amino]quinolin-3-yl]methyl]amino]-N-methylethanimidamide |
| SMILES | [H]/N=C(\CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc2ccccc2nc1N(CC)CC1CCCC1)N(C)N |
| InChI | InChI=1S/C30H36F6N6/c1-3-42(17-20-8-4-5-9-20)28-23(14-22-10-6-7-11-26(22)39-28)18-41(19-27(37)40(2)38)16-21-12-24(29(31,32)33)15-25(13-21)30(34,35)36/h6-7,10-15,20,37H,3-5,8-9,16-19,38H2,1-2H3/b37-27+ |
| InChIKey | AOVQXEISBMMUFX-NXEFEZKASA-N |
| XLogP | 7.07 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|