C25H30F9N7 — CID 143494114
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentyl(ethyl)amino]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine (PubChem CID 143494114) has the molecular formula C25H30F9N7 and a molecular weight of 599.55 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentyl(ethyl)amino]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentyl(ethyl)amino]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 143494114 |
| Molecular Formula | C25H30F9N7 |
| Molecular Weight | 599.55 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[cyclopentyl(ethyl)amino]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN(c1ncc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)C1CCCC1 |
| InChI | InChI=1S/C25H30F9N7/c1-3-41(20-6-4-5-7-20)21-16(10-19(12-37-21)25(32,33)34)14-40(22(35)38-39(2)36)13-15-8-17(23(26,27)28)11-18(9-15)24(29,30)31/h8-12,20H,3-7,13-14,36H2,1-2H3,(H2,35,38) |
| InChIKey | HQHORNUGPLWNCG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|