C27H35F9N8 — CID 143672517
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propyl]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine (PubChem CID 143672517) has the molecular formula C27H35F9N8 and a molecular weight of 642.62 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propyl]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propyl]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 143672517 |
| Molecular Formula | C27H35F9N8 |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]propyl]-5-(trifluoromethyl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCC(c1ncc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)N1CC[C@H](N(C)C)C1 |
| InChI | InChI=1S/C27H35F9N8/c1-5-22(43-7-6-21(15-43)41(2)3)23-17(10-20(12-39-23)27(34,35)36)14-44(24(37)40-42(4)38)13-16-8-18(25(28,29)30)11-19(9-16)26(31,32)33/h8-12,21-22H,5-7,13-15,38H2,1-4H3,(H2,37,40)/t21-,22?/m0/s1 |
| InChIKey | MYDGEQUZFJGBJP-HMTLIYDFSA-N |
| XLogP | 5.26 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|