C30H39F9N6O — CID 143538984
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(2-methyl-1-morpholin-4-ylhexyl)-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 143538984) has the molecular formula C30H39F9N6O and a molecular weight of 670.67 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(2-methyl-1-morpholin-4-ylhexyl)-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(2-methyl-1-morpholin-4-ylhexyl)-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 143538984 |
| Molecular Formula | C30H39F9N6O |
| Molecular Weight | 670.67 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(2-methyl-1-morpholin-4-ylhexyl)-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCCCC(C)C(c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)N1CCOCC1 |
| InChI | InChI=1S/C30H39F9N6O/c1-4-5-6-19(2)26(44-9-11-46-12-10-44)25-8-7-22(28(31,32)33)15-21(25)18-45(27(40)42-43(3)41)17-20-13-23(29(34,35)36)16-24(14-20)30(37,38)39/h7-8,13-16,19,26H,4-6,9-12,17-18,41H2,1-3H3,(H2,40,42) |
| InChIKey | JQTVOVNNDNAINH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|