C32H30F9N5 — CID 143233295
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[5-(difluoromethyl)-2-(2-phenylphenyl)phenyl]methyl]guanidine;fluoromethane (PubChem CID 143233295) has the molecular formula C32H30F9N5 and a molecular weight of 655.61 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[5-(difluoromethyl)-2-(2-phenylphenyl)phenyl]methyl]guanidine;fluoromethane.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[5-(difluoromethyl)-2-(2-phenylphenyl)phenyl]methyl]guanidine;fluoromethane |
|---|---|
| PubChem CID | 143233295 |
| Molecular Formula | C32H30F9N5 |
| Molecular Weight | 655.61 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[5-(difluoromethyl)-2-(2-phenylphenyl)phenyl]methyl]guanidine;fluoromethane |
| SMILES | CF.CN(N)/N=C(\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)F)ccc1-c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C31H27F8N5.CH3F/c1-43(41)42-29(40)44(17-19-13-23(30(34,35)36)16-24(14-19)31(37,38)39)18-22-15-21(28(32)33)11-12-26(22)27-10-6-5-9-25(27)20-7-3-2-4-8-20;1-2/h2-16,28H,17-18,41H2,1H3,(H2,40,42);1H3 |
| InChIKey | ZEWODXDOUCYYQG-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.61 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|