C28H33F9N8 — CID 143233305
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[2-(dimethylamino)ethyl]-4-ethylpyrazol-3-yl]-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 143233305) has the molecular formula C28H33F9N8 and a molecular weight of 652.61 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[2-(dimethylamino)ethyl]-4-ethylpyrazol-3-yl]-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[2-(dimethylamino)ethyl]-4-ethylpyrazol-3-yl]-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 143233305 |
| Molecular Formula | C28H33F9N8 |
| Molecular Weight | 652.61 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[2-(dimethylamino)ethyl]-4-ethylpyrazol-3-yl]-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCc1cn(CCN(C)C)nc1-c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N |
| InChI | InChI=1S/C28H33F9N8/c1-5-18-16-45(9-8-42(2)3)40-24(18)23-7-6-20(26(29,30)31)12-19(23)15-44(25(38)41-43(4)39)14-17-10-21(27(32,33)34)13-22(11-17)28(35,36)37/h6-7,10-13,16H,5,8-9,14-15,39H2,1-4H3,(H2,38,41) |
| InChIKey | GCFYBPFJDVOKDD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|