C24H28F9N5O — CID 143539096
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-methoxy-2-methylpropyl)-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 143539096) has the molecular formula C24H28F9N5O and a molecular weight of 573.50 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-methoxy-2-methylpropyl)-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-methoxy-2-methylpropyl)-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 143539096 |
| Molecular Formula | C24H28F9N5O |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-(1-methoxy-2-methylpropyl)-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | COC(c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)C(C)C |
| InChI | InChI=1S/C24H28F9N5O/c1-13(2)20(39-4)19-6-5-16(22(25,26)27)9-15(19)12-38(21(34)36-37(3)35)11-14-7-17(23(28,29)30)10-18(8-14)24(31,32)33/h5-10,13,20H,11-12,35H2,1-4H3,(H2,34,36) |
| InChIKey | FWXZGPBGTAALNV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|