C30H35F9N8O — CID 143539062
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]propyl]-5-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 143539062) has the molecular formula C30H35F9N8O and a molecular weight of 694.65 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]propyl]-5-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]propyl]-5-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 143539062 |
| Molecular Formula | C30H35F9N8O |
| Molecular Weight | 694.65 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)piperidin-1-yl]propyl]-5-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCC(c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)N1CCCC(c2noc(C)n2)C1 |
| InChI | InChI=1S/C30H35F9N8O/c1-4-25(46-9-5-6-19(15-46)26-42-17(2)48-44-26)24-8-7-21(28(31,32)33)12-20(24)16-47(27(40)43-45(3)41)14-18-10-22(29(34,35)36)13-23(11-18)30(37,38)39/h7-8,10-13,19,25H,4-6,9,14-16,41H2,1-3H3,(H2,40,43) |
| InChIKey | STJHPLRJRJKQLP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|