C27H32F9N5O2 — CID 143539031
5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]methyl]-4-(trifluoromethyl)phenyl]ethyl-methylamino]pentanoic acid (PubChem CID 143539031) has the molecular formula C27H32F9N5O2 and a molecular weight of 629.57 g/mol. Its IUPAC name is 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]methyl]-4-(trifluoromethyl)phenyl]ethyl-methylamino]pentanoic acid.
| Compound Name | 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]methyl]-4-(trifluoromethyl)phenyl]ethyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 143539031 |
| Molecular Formula | C27H32F9N5O2 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[(E)-N'-(methylamino)carbamimidoyl]amino]methyl]-4-(trifluoromethyl)phenyl]ethyl-methylamino]pentanoic acid |
| SMILES | CN/N=C(\N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1cc(C(F)(F)F)ccc1C(C)N(C)CCCCC(=O)O |
| InChI | InChI=1S/C27H32F9N5O2/c1-16(40(3)9-5-4-6-23(42)43)22-8-7-19(25(28,29)30)12-18(22)15-41(24(37)39-38-2)14-17-10-20(26(31,32)33)13-21(11-17)27(34,35)36/h7-8,10-13,16,38H,4-6,9,14-15H2,1-3H3,(H2,37,39)(H,42,43) |
| InChIKey | SJVMGBXMOQAJDH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|