C33H32F9N5S — CID 143233325
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[5-ethyl-2-(3-phenylpropyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenyl]methyl]-2-(methylamino)guanidine (PubChem CID 143233325) has the molecular formula C33H32F9N5S and a molecular weight of 701.70 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[5-ethyl-2-(3-phenylpropyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenyl]methyl]-2-(methylamino)guanidine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[5-ethyl-2-(3-phenylpropyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenyl]methyl]-2-(methylamino)guanidine |
|---|---|
| PubChem CID | 143233325 |
| Molecular Formula | C33H32F9N5S |
| Molecular Weight | 701.70 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[5-ethyl-2-(3-phenylpropyl)-1,3-thiazol-4-yl]-5-(trifluoromethyl)phenyl]methyl]-2-(methylamino)guanidine |
| SMILES | CCc1sc(CCCc2ccccc2)nc1-c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/NC |
| InChI | InChI=1S/C33H32F9N5S/c1-3-27-29(45-28(48-27)11-7-10-20-8-5-4-6-9-20)26-13-12-23(31(34,35)36)16-22(26)19-47(30(43)46-44-2)18-21-14-24(32(37,38)39)17-25(15-21)33(40,41)42/h4-6,8-9,12-17,44H,3,7,10-11,18-19H2,1-2H3,(H2,43,46) |
| InChIKey | LKBWAVFDIAXMJO-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.70 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|