C28H33F9N6O2 — CID 173495967
5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(N-methyliminocarbamohydrazonoyl)amino]methyl]-4-(trifluoromethyl)phenyl]propyl-methylamino]pentanoic acid (PubChem CID 173495967) has the molecular formula C28H33F9N6O2 and a molecular weight of 656.59 g/mol. Its IUPAC name is 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(N-methyliminocarbamohydrazonoyl)amino]methyl]-4-(trifluoromethyl)phenyl]propyl-methylamino]pentanoic acid.
| Compound Name | 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(N-methyliminocarbamohydrazonoyl)amino]methyl]-4-(trifluoromethyl)phenyl]propyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 173495967 |
| Molecular Formula | C28H33F9N6O2 |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 656.25 |
| IUPAC Name | 5-[1-[2-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(N-methyliminocarbamohydrazonoyl)amino]methyl]-4-(trifluoromethyl)phenyl]propyl-methylamino]pentanoic acid |
| SMILES | CCC(c1ccc(C(F)(F)F)cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=NN)/N=N/C)N(C)CCCCC(=O)O |
| InChI | InChI=1S/C28H33F9N6O2/c1-4-23(42(3)10-6-5-7-24(44)45)22-9-8-19(26(29,30)31)13-18(22)16-43(25(40-38)41-39-2)15-17-11-20(27(32,33)34)14-21(12-17)28(35,36)37/h8-9,11-14,23H,4-7,10,15-16,38H2,1-3H3,(H,44,45)/b40-25?,41-39+ |
| InChIKey | ZKBUPGLMDSUNOZ-ZZXIROKBSA-N |
| XLogP | 7.69 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|