C29H41F6N9 — CID 143258758
2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[6-[butyl(pentyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl]guanidine (PubChem CID 143258758) has the molecular formula C29H41F6N9 and a molecular weight of 629.70 g/mol. Its IUPAC name is 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[6-[butyl(pentyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl]guanidine.
| Compound Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[6-[butyl(pentyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl]guanidine |
|---|---|
| PubChem CID | 143258758 |
| Molecular Formula | C29H41F6N9 |
| Molecular Weight | 629.70 g/mol |
| Exact Mass | 629.34 |
| IUPAC Name | 2-[amino(methyl)amino]-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[6-[butyl(pentyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl]guanidine |
| SMILES | CCCCCN(CCCC)c1nc2c(cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N(C)N)c(C)nn2C |
| InChI | InChI=1S/C29H41F6N9/c1-6-8-10-12-43(11-9-7-2)25-21(15-24-19(3)39-41(4)26(24)38-25)18-44(27(36)40-42(5)37)17-20-13-22(28(30,31)32)16-23(14-20)29(33,34)35/h13-16H,6-12,17-18,37H2,1-5H3,(H2,36,40) |
| InChIKey | PVFBMIMMNYFHCC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|