C26H34F6N8O2 — CID 143578957
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[ethyl(2-ethylpentyl)amino]-5-nitro-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine (PubChem CID 143578957) has the molecular formula C26H34F6N8O2 and a molecular weight of 604.60 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[ethyl(2-ethylpentyl)amino]-5-nitro-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[ethyl(2-ethylpentyl)amino]-5-nitro-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine |
|---|---|
| PubChem CID | 143578957 |
| Molecular Formula | C26H34F6N8O2 |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[[2-[ethyl(2-ethylpentyl)amino]-5-nitro-3-pyridinyl]methyl]-2-(methyldiazenyl)guanidine |
| SMILES | CCCC(CC)CN(CC)c1ncc([N+](=O)[O-])cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)/C(N)=N/N=N/C |
| InChI | InChI=1S/C26H34F6N8O2/c1-5-8-17(6-2)14-38(7-3)23-19(11-22(13-35-23)40(41)42)16-39(24(33)36-37-34-4)15-18-9-20(25(27,28)29)12-21(10-18)26(30,31)32/h9-13,17H,5-8,14-16H2,1-4H3,(H2,33,34,36) |
| InChIKey | FMFNNTIYNXHGKH-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|