C7H5N5O — CID 143260927
4-(hydroxyamino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 143260927) has the molecular formula C7H5N5O and a molecular weight of 175.15 g/mol. Its IUPAC name is 4-(hydroxyamino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile.
| Compound Name | 4-(hydroxyamino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 143260927 |
| Molecular Formula | C7H5N5O |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-(hydroxyamino)-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c[nH]c2ncnc(NO)c12 |
| InChI | InChI=1S/C7H5N5O/c8-1-4-2-9-6-5(4)7(12-13)11-3-10-6/h2-3,13H,(H2,9,10,11,12) |
| InChIKey | RUFUFNMSDABZJK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|