About disodium;2-(2-oxidophenyl)acetate
disodium;2-(2-oxidophenyl)acetate (PubChem CID 14326222) has the molecular formula C8H6Na2O3
and a molecular weight of 196.11 g/mol. Its IUPAC name is disodium;2-(2-oxidophenyl)acetate.
Molecular Properties
| Compound Name | disodium;2-(2-oxidophenyl)acetate |
| PubChem CID | 14326222 |
| Molecular Formula | C8H6Na2O3 |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | disodium;2-(2-oxidophenyl)acetate |
| SMILES | O=C([O-])Cc1ccccc1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H8O3.2Na/c9-7-4-2-1-3-6(7)5-8(10)11;;/h1-4,9H,5H2,(H,10,11);;/q;2*+1/p-2 |
| InChIKey | ULXDJOJYHMCNTM-UHFFFAOYSA-L |
| XLogP | -6.94 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | -6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;2-(2-oxidophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-(2-oxidophenyl)acetate?
The IUPAC name of disodium;2-(2-oxidophenyl)acetate (CID 14326222) is disodium;2-(2-oxidophenyl)acetate.
What is the SMILES notation for disodium;2-(2-oxidophenyl)acetate?
The canonical SMILES for disodium;2-(2-oxidophenyl)acetate is O=C([O-])Cc1ccccc1[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-(2-oxidophenyl)acetate?
The InChIKey is ULXDJOJYHMCNTM-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H8O3.2Na/c9-7-4-2-1-3-6(7)5-8(10)11;;/h1-4,9H,5H2,(H,10,11);;/q;2*+1/p-2.
What are the key properties of disodium;2-(2-oxidophenyl)acetate?
disodium;2-(2-oxidophenyl)acetate has a molecular weight of 196.11 g/mol, XLogP of -6.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-(2-oxidophenyl)acetate is sourced from PubChem (CID 14326222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).