C14H12NNaO2 — CID 46780340
sodium 2-[2-(2,3,4,5,6-pentadeuterioanilino)phenyl]acetate (PubChem CID 46780340) has the molecular formula C14H12NNaO2 and a molecular weight of 254.28 g/mol. Its IUPAC name is sodium 2-[2-(2,3,4,5,6-pentadeuterioanilino)phenyl]acetate.
| Compound Name | sodium 2-[2-(2,3,4,5,6-pentadeuterioanilino)phenyl]acetate |
|---|---|
| PubChem CID | 46780340 |
| Molecular Formula | C14H12NNaO2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | sodium 2-[2-(2,3,4,5,6-pentadeuterioanilino)phenyl]acetate |
| SMILES | [2H]c1c([2H])c([2H])c(Nc2ccccc2CC(=O)[O-])c([2H])c1[2H].[Na+] |
| InChI | InChI=1S/C14H13NO2.Na/c16-14(17)10-11-6-4-5-9-13(11)15-12-7-2-1-3-8-12;/h1-9,15H,10H2,(H,16,17);/q;+1/p-1/i1D,2D,3D,7D,8D; |
| InChIKey | KZUYUTHJCBYZJK-ZAXNCOASSA-M |
| XLogP | -1.27 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |