C14H10Cl3NO2 — CID 18546366
2-[2-(3,4,5-trichloroanilino)phenyl]acetic acid (PubChem CID 18546366) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 2-[2-(3,4,5-trichloroanilino)phenyl]acetic acid.
| Compound Name | 2-[2-(3,4,5-trichloroanilino)phenyl]acetic acid |
|---|---|
| PubChem CID | 18546366 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-[2-(3,4,5-trichloroanilino)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3NO2/c15-10-6-9(7-11(16)14(10)17)18-12-4-2-1-3-8(12)5-13(19)20/h1-4,6-7,18H,5H2,(H,19,20) |
| InChIKey | FYUOWIHKGJIJSY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|