C16H28N2 — CID 143262230
N-[(E)-1-[(Z)-[(Z)-3-methylpent-3-en-2-ylidene]amino]but-1-enyl]cyclohexanamine (PubChem CID 143262230) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-[(E)-1-[(Z)-[(Z)-3-methylpent-3-en-2-ylidene]amino]but-1-enyl]cyclohexanamine.
| Compound Name | N-[(E)-1-[(Z)-[(Z)-3-methylpent-3-en-2-ylidene]amino]but-1-enyl]cyclohexanamine |
|---|---|
| PubChem CID | 143262230 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-[(E)-1-[(Z)-[(Z)-3-methylpent-3-en-2-ylidene]amino]but-1-enyl]cyclohexanamine |
| SMILES | C/C=C(C)\C(C)=N/C(=C/CC)NC1CCCCC1 |
| InChI | InChI=1S/C16H28N2/c1-5-10-16(17-14(4)13(3)6-2)18-15-11-8-7-9-12-15/h6,10,15,18H,5,7-9,11-12H2,1-4H3/b13-6-,16-10-,17-14- |
| InChIKey | JIFWFTCEOZWGNJ-YGULMXCHSA-N |
| XLogP | 4.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|