C42H52O9 — CID 143264261
2-[4-[4-(6-buta-1,3-dien-2-yloxyhexoxy)benzoyl]oxyphenyl]ethyl 4-(6-methoxyhexoxy)benzoate;prop-2-enal (PubChem CID 143264261) has the molecular formula C42H52O9 and a molecular weight of 700.87 g/mol. Its IUPAC name is 2-[4-[4-(6-buta-1,3-dien-2-yloxyhexoxy)benzoyl]oxyphenyl]ethyl 4-(6-methoxyhexoxy)benzoate;prop-2-enal.
| Compound Name | 2-[4-[4-(6-buta-1,3-dien-2-yloxyhexoxy)benzoyl]oxyphenyl]ethyl 4-(6-methoxyhexoxy)benzoate;prop-2-enal |
|---|---|
| PubChem CID | 143264261 |
| Molecular Formula | C42H52O9 |
| Molecular Weight | 700.87 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | 2-[4-[4-(6-buta-1,3-dien-2-yloxyhexoxy)benzoyl]oxyphenyl]ethyl 4-(6-methoxyhexoxy)benzoate;prop-2-enal |
| SMILES | C=CC(=C)OCCCCCCOc1ccc(C(=O)Oc2ccc(CCOC(=O)c3ccc(OCCCCCCOC)cc3)cc2)cc1.C=CC=O |
| InChI | InChI=1S/C39H48O8.C3H4O/c1-4-31(2)43-27-10-7-8-12-29-45-36-23-17-34(18-24-36)39(41)47-37-19-13-32(14-20-37)25-30-46-38(40)33-15-21-35(22-16-33)44-28-11-6-5-9-26-42-3;1-2-3-4/h4,13-24H,1-2,5-12,25-30H2,3H3;2-3H,1H2 |
| InChIKey | AVHKSIPNAJLHJP-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.87 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|