About formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine
formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine (PubChem CID 143264417) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine |
| PubChem CID | 143264417 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine |
| SMILES | C=O.CONCC1=CC=C(OC)CC1 |
| InChI | InChI=1S/C9H15NO2.CH2O/c1-11-9-5-3-8(4-6-9)7-10-12-2;1-2/h3,5,10H,4,6-7H2,1-2H3;1H2 |
| InChIKey | SQJICHOKCBYPGA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The IUPAC name of formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine (CID 143264417) is formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine.
What is the SMILES notation for formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The canonical SMILES for formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine is C=O.CONCC1=CC=C(OC)CC1.
What is the InChIKey of formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
The InChIKey is SQJICHOKCBYPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.CH2O/c1-11-9-5-3-8(4-6-9)7-10-12-2;1-2/h3,5,10H,4,6-7H2,1-2H3;1H2.
What are the key properties of formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine?
formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine has a molecular weight of 199.25 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;N-methoxy-1-(4-methoxycyclohexa-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 143264417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).