C20H26N2OS2 — CID 143264429
4-anilinosulfanyl-N-[(4R)-4-methylcyclohex-2-en-1-yl]sulfanylaniline;methanol (PubChem CID 143264429) has the molecular formula C20H26N2OS2 and a molecular weight of 374.58 g/mol. Its IUPAC name is 4-anilinosulfanyl-N-[(4R)-4-methylcyclohex-2-en-1-yl]sulfanylaniline;methanol.
| Compound Name | 4-anilinosulfanyl-N-[(4R)-4-methylcyclohex-2-en-1-yl]sulfanylaniline;methanol |
|---|---|
| PubChem CID | 143264429 |
| Molecular Formula | C20H26N2OS2 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-anilinosulfanyl-N-[(4R)-4-methylcyclohex-2-en-1-yl]sulfanylaniline;methanol |
| SMILES | CO.C[C@H]1C=CC(SNc2ccc(SNc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C19H22N2S2.CH4O/c1-15-7-11-18(12-8-15)22-21-17-9-13-19(14-10-17)23-20-16-5-3-2-4-6-16;1-2/h2-7,9-11,13-15,18,20-21H,8,12H2,1H3;2H,1H3/t15-,18?;/m0./s1 |
| InChIKey | JLNIFPNQPOBYHL-PDFNFFLASA-N |
| XLogP | 5.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|