C39H35BrIN — CID 143268544
2'-bromo-2-tert-butyl-10-(4-tert-butylphenyl)-7'-iodospiro[acridine-9,9'-fluorene] (PubChem CID 143268544) has the molecular formula C39H35BrIN and a molecular weight of 724.52 g/mol. Its IUPAC name is 2'-bromo-2-tert-butyl-10-(4-tert-butylphenyl)-7'-iodospiro[acridine-9,9'-fluorene].
| Compound Name | 2'-bromo-2-tert-butyl-10-(4-tert-butylphenyl)-7'-iodospiro[acridine-9,9'-fluorene] |
|---|---|
| PubChem CID | 143268544 |
| Molecular Formula | C39H35BrIN |
| Molecular Weight | 724.52 g/mol |
| Exact Mass | 723.10 |
| IUPAC Name | 2'-bromo-2-tert-butyl-10-(4-tert-butylphenyl)-7'-iodospiro[acridine-9,9'-fluorene] |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3C3(c4cc(Br)ccc4-c4ccc(I)cc43)c3cc(C(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C39H35BrIN/c1-37(2,3)24-11-16-28(17-12-24)42-35-10-8-7-9-31(35)39(34-21-25(38(4,5)6)13-20-36(34)42)32-22-26(40)14-18-29(32)30-19-15-27(41)23-33(30)39/h7-23H,1-6H3 |
| InChIKey | FEUZYQSIRWBWEX-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.52 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|