C45H55N3O7 — CID 143271869
1-[(2E)-4-(3,5-dimethoxy-4-methylphenyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 143271869) has the molecular formula C45H55N3O7 and a molecular weight of 749.95 g/mol. Its IUPAC name is 1-[(2E)-4-(3,5-dimethoxy-4-methylphenyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | 1-[(2E)-4-(3,5-dimethoxy-4-methylphenyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 143271869 |
| Molecular Formula | C45H55N3O7 |
| Molecular Weight | 749.95 g/mol |
| Exact Mass | 749.40 |
| IUPAC Name | 1-[(2E)-4-(3,5-dimethoxy-4-methylphenyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-N-(3,5-dimethoxyphenyl)-N-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | C=C(/C=C(\C=C/C)CN1CCC(N(Cc2ccnc(-c3cc(OC)c(OC)c(OC)c3)c2)c2cc(OC)cc(OC)c2)CC1)c1cc(OC)c(C)c(OC)c1 |
| InChI | InChI=1S/C45H55N3O7/c1-11-12-32(19-30(2)34-21-41(51-6)31(3)42(22-34)52-7)28-47-17-14-36(15-18-47)48(37-25-38(49-4)27-39(26-37)50-5)29-33-13-16-46-40(20-33)35-23-43(53-8)45(55-10)44(24-35)54-9/h11-13,16,19-27,36H,2,14-15,17-18,28-29H2,1,3-10H3/b12-11-,32-19+ |
| InChIKey | OTGNBOJFUZIBJA-OFYBIMBWSA-N |
| XLogP | 8.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.95 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|