C29H27ClN6O4 — CID 143273796
2-[[2-[[2-(2-chlorophenyl)-5-(4-pyrimidin-5-yloxyphenyl)pyrrol-1-yl]methyl]-2-methyl-6-nitro-3H-pyridin-5-yl]amino]ethanol (PubChem CID 143273796) has the molecular formula C29H27ClN6O4 and a molecular weight of 559.03 g/mol. Its IUPAC name is 2-[[2-[[2-(2-chlorophenyl)-5-(4-pyrimidin-5-yloxyphenyl)pyrrol-1-yl]methyl]-2-methyl-6-nitro-3H-pyridin-5-yl]amino]ethanol.
| Compound Name | 2-[[2-[[2-(2-chlorophenyl)-5-(4-pyrimidin-5-yloxyphenyl)pyrrol-1-yl]methyl]-2-methyl-6-nitro-3H-pyridin-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 143273796 |
| Molecular Formula | C29H27ClN6O4 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-[[2-[[2-(2-chlorophenyl)-5-(4-pyrimidin-5-yloxyphenyl)pyrrol-1-yl]methyl]-2-methyl-6-nitro-3H-pyridin-5-yl]amino]ethanol |
| SMILES | CC1(Cn2c(-c3ccc(Oc4cncnc4)cc3)ccc2-c2ccccc2Cl)CC=C(NCCO)C([N+](=O)[O-])=N1 |
| InChI | InChI=1S/C29H27ClN6O4/c1-29(13-12-25(33-14-15-37)28(34-29)36(38)39)18-35-26(10-11-27(35)23-4-2-3-5-24(23)30)20-6-8-21(9-7-20)40-22-16-31-19-32-17-22/h2-12,16-17,19,33,37H,13-15,18H2,1H3 |
| InChIKey | QQFGWNBVEVDGLC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|