C18H26F3NO2S — CID 143275238
3-[[1-[1-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]amino]propane-1-sulfinic acid (PubChem CID 143275238) has the molecular formula C18H26F3NO2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-[[1-[1-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]amino]propane-1-sulfinic acid.
| Compound Name | 3-[[1-[1-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 143275238 |
| Molecular Formula | C18H26F3NO2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[[1-[1-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl]amino]propane-1-sulfinic acid |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)C1(NCCCS(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H26F3NO2S/c1-14(15-6-8-16(9-7-15)18(19,20)21)17(10-3-2-4-11-17)22-12-5-13-25(23)24/h6-9,14,22H,2-5,10-13H2,1H3,(H,23,24) |
| InChIKey | FJFQWUVUHXKRBD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|