C19H25F3N2O2 — CID 124742880
N-ethyl-1-[[(3R)-3-[4-(trifluoromethyl)phenyl]butanoyl]amino]cyclopentane-1-carboxamide (PubChem CID 124742880) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-ethyl-1-[[(3R)-3-[4-(trifluoromethyl)phenyl]butanoyl]amino]cyclopentane-1-carboxamide.
| Compound Name | N-ethyl-1-[[(3R)-3-[4-(trifluoromethyl)phenyl]butanoyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 124742880 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-ethyl-1-[[(3R)-3-[4-(trifluoromethyl)phenyl]butanoyl]amino]cyclopentane-1-carboxamide |
| SMILES | CCNC(=O)C1(NC(=O)C[C@@H](C)c2ccc(C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-3-23-17(26)18(10-4-5-11-18)24-16(25)12-13(2)14-6-8-15(9-7-14)19(20,21)22/h6-9,13H,3-5,10-12H2,1-2H3,(H,23,26)(H,24,25)/t13-/m1/s1 |
| InChIKey | YIQSHGROSGHCJP-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |