C11H14O2 — CID 143275947
6-ethyl-2,3,5,6-tetrahydrochromen-4-one (PubChem CID 143275947) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-ethyl-2,3,5,6-tetrahydrochromen-4-one.
| Compound Name | 6-ethyl-2,3,5,6-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 143275947 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-ethyl-2,3,5,6-tetrahydrochromen-4-one |
| SMILES | CCC1C=CC2=C(C1)C(=O)CCO2 |
| InChI | InChI=1S/C11H14O2/c1-2-8-3-4-11-9(7-8)10(12)5-6-13-11/h3-4,8H,2,5-7H2,1H3 |
| InChIKey | DCQLPEPQXZIXKJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |